电 话:xxxx-00000000
传 真:xxxx-000000
邮 箱:xxxxx.cn
地 址:xxxxxxxxxx
English name | 1,3-Dimethyladamantane |
English synonyms | Tricyclo[3.3.1.1(3,7)]decane,1,3-dimethyl-;tricyclo[3.3.1.13,7]decane,1,3-dimethyl-; |
CAS number | 702-79-4 |
Molecular formula | C12H20 |
Molecular weight | 164.29 |
EINECS number | 211-870-8 |
1,3-Dimethyladamantane Chemical Properties | |
Melting point | -30℃ |
Boiling point | 201.5℃ |
Density | 0.886g/mL at 25℃(lit.) |
Refractive index | n20/D 1.478(lit.) |
Flash point | 127°F |
Storage conditions | 2-8℃ |
Solubility | Soluble in chloroform (a little), methanol (a little) |
Form | Transparent liquid |
Specific gravity | 0.886 |
Color | Colorless to almost colorless |
Stability | Stable. Incompatible with strong oxidants. Flammable. |
InChl | InChl=1S/C12H20/c1-11-4-9-3-10(5-11)7-12(2,6-9)8-11/h9-10H,3-8H2,1-2H3 |
InChlKey | CWNOIUTVJRWADX-UHFFFAOYSA-N |
SMILES | C12(C)CC3CC(CC(C)(C3)C1)C2 |
CAS database | 702-79-4(CAS DataBase Reference) |
NIST chemical substance information | Adamantane,1,3-dimethyl-(702-79-4) |
Chemical properties |
Colorless liquid, density 0.886. |
Uses |
Memantine intermediate. |
Uses |
Mainly used in the synthesis of medicines, such as memantine hydrochloride, and the treatment of Alzheimer's disease |
Uses |
1,3-Dimethyladamantane is mainly used in the synthesis of medicines, such as memantine hydrochloride, and the treatment of Alzheimer's disease. |
Uses |
Used as an intermediate of the drug memantine |
Safety information | |
Hazardous goods symbol | F |
Hazard category code | 10 |
Safety instructions | 16-60 |
Hazardous goods transport number | UN 19933/PG 3 |
WGK Germany | 3 |
Hazard level | 3 |
Packaging category | Ⅲ |
Customs code | 29021990 |
1,3-Dimethyladamantane Upstream and downstream product information |
Upstream raw materials |
1,3-Dibromoadamantane, 1-Bromoadamantane, 1-Methyladamantane, 1,3,5-Trimethyladamantane, 1-Chloroadamantane, 1,3,5,7-Tetramethyladamantane |
sales@yuntao-chem.com